Product Name:[1,1'-Biphenyl]-4,4'-dicarboxylic acid

IUPAC Name:[1,1'-biphenyl]-4,4'-dicarboxylic acid

CAS:787-70-2
Molecular Formula:C14H10O4
Purity:98%+
Catalog Number:CM255063
Molecular Weight:242.23

Packing Unit Available Stock Price($) Quantity
CM255063-500g in stock ȐǶǶ

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:787-70-2
Molecular Formula:C14H10O4
Melting Point:-
Smiles Code:O=C(C1=CC=C(C2=CC=C(C(O)=O)C=C2)C=C1)O
Density:
Catalog Number:CM255063
Molecular Weight:242.23
Boiling Point:
MDL No:MFCD00002554
Storage:Store at room temperature.

Category Infos

Hydrogen Storage Materials
Hydrogen storage materials are materials which can store and release hydrogen gas. These materials are important for the development of hydrogen fuel cell technology, as they allow for the safe and efficient storage of hydrogen. There are several types of hydrogen storage materials, including: 1. Sorbent Materials. Carbon-based materials such as nanotubes, fullerenes, graphene, mesoporous silica, metal-organic frameworks (MOFs), isoreticular metal-organic frameworks (IRMOFs), covalent-organic frameworks (COFs), and clathrates belong to this category. 2. Complex Hydrides. These consist of light metal hydrides and chemical hydrides. 3. Nanostructured materials. These are composed of functionalized sorbent materials as well as nanoparticles of complex hydrides. The development of efficient and cost-effective hydrogen storage materials is crucial for the widespread adoption of hydrogen fuel cell technology.