Product Name:4-[2-(4-Aminophenyl)ethynyl]aniline

IUPAC Name:4-[2-(4-aminophenyl)ethynyl]aniline

CAS:6052-15-9
Molecular Formula:C14H12N2
Purity:97%+
Catalog Number:CM449496
Molecular Weight:208.26

Packing Unit Available Stock Price($) Quantity
CM449496-250mg in stock ƴȖ
CM449496-1g in stock džœƚ
CM449496-5g in stock ȖȤȖ

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:6052-15-9
Molecular Formula:C14H12N2
Melting Point:-
Smiles Code:NC1=CC=C(C=C1)C#CC1=CC=C(N)C=C1
Density:
Catalog Number:CM449496
Molecular Weight:208.26
Boiling Point:
MDL No:MFCD00458961
Storage:

Related Products



Product Other Information

Product Overview 4-[2-(4-Aminophenyl)ethynyl]aniline is a chemical compound with the molecular formula C14H12N2. It is also known by other names such as 4-(4-Aminophenylethynyl)aniline or 4-[(4-Aminophenyl)ethynyl]aniline.
This compound consists of a central aniline group, which is attached to a phenyl group through a carbon-carbon triple bond. The aniline group contains an amino group (-NH2) attached to a benzene ring, while the phenyl group is a benzene ring without any substituents.
The compound is a yellowish solid with a molecular weight of approximately 208.26 grams per mole. It has a melting point of around 164-165 °C.
4-[2-(4-Aminophenyl)ethynyl]aniline is often used in organic synthesis and pharmaceutical research due to its unique chemical structure. It can be utilized as a building block for the synthesis of various organic compounds and can also exhibit interesting biological activities.
Applications 4-[2-(4-Aminophenyl)ethynyl]aniline is a chemical compound with various potential applications. Here are a few notable applications:
1. Organic Electronics: This compound has been studied for its potential use in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaic cells (OPVs). It can be used as a building block in the synthesis of conjugated polymers and small molecules for these applications.
2. Sensing and Detection: Due to its unique structure and properties, 4-[2-(4-Aminophenyl)ethynyl]aniline has been explored for its sensing and detection capabilities. It can be used as a fluorescent probe for the detection of various analytes, including metal ions, biomolecules, and environmental pollutants.
3. Medicinal Chemistry: This compound has shown potential in medicinal chemistry and drug discovery. It has been investigated for its anticancer properties and has exhibited inhibitory effects on certain cancer cell lines. Further research is needed to explore its full therapeutic potential.
4. Material Science: 4-[2-(4-Aminophenyl)ethynyl]aniline can be used as a building block for the synthesis of functional materials. It has been utilized in the development of conducting polymers, molecular wires, and other materials with unique electronic and optical properties.
5. Chemical Synthesis: This compound can serve as a versatile intermediate in various chemical syntheses. Its reactive amino and ethynyl groups allow for further functionalization and modification, enabling the synthesis of a wide range of compounds with diverse applications.