Product Name:1-Oxa-3,7-diazaspiro[4.4]nonan-2-one hydrochloride

IUPAC Name:1-oxa-3,7-diazaspiro[4.4]nonan-2-one hydrochloride

CAS:1657033-44-7
Molecular Formula:C6H11ClN2O2
Purity:97%
Catalog Number:CM210963
Molecular Weight:178.62

Packing Unit Available Stock Price($) Quantity

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:1657033-44-7
Molecular Formula:C6H11ClN2O2
Melting Point:-
Smiles Code:O=C1OC2(CNCC2)CN1.[H]Cl
Density:
Catalog Number:CM210963
Molecular Weight:178.62
Boiling Point:
MDL No:MFCD22666513
Storage:Store at room temperature.

Category Infos

Spiro Compounds
A spiro compound is a polycyclic compound in which two monocyclic rings share one carbon atom; the shared carbon atom is called a spiro atom. Spiro compounds have rigid structures, stable structures, and have special properties that general organic compounds do not possess, such as anomeric effect, spiro conjugation and spiro hyperconjugation. Compared with the monocyclic structure or the planar aromatic structure, the spiro structure has a larger three-dimensional structure; the heterocyclic spiro structure is also regarded as the biological isostere of some groups, which can change the drug to a certain extent. The water solubility, lipophilicity, dominant conformation and ADMET properties of the molecule make the optimized lead molecule easier to drug. Therefore, spiro compounds occupy a very important position in drug development.
Spiro And Bicyclic Compound
Hot sale various high quality spiro and bicyclic compound from china leading manufacturer. Our products are efficient, cost effective and deliver more benefits. welcome to choose us!
Pyrrolidines
Pyrrolidine, also known as tetrahydropyrrole, is a saturated five-membered heterocyclic ring, which is miscible with water. Pyrrolidine exists in many alkaloids and drug molecules, such as kappa opioids, antagonists of dopamine D4 receptors, and HIV reverse transcriptase inhibitors.
Oxazolidines
Oxazolidines are five-membered ring compounds consisting of three carbons, nitrogen and oxygen. Oxygen and nitrogen are in the 1 and 3 positions, respectively. Oxazolidine is in general yellow or slightly yellow, alkaline liquid or solid, easily hydrolyzed by water or alcohol. It is insoluble in water (or hydrolyzed); soluble in benzene and chloroform. Oxazolidine derivatives are five-membered cyclic compounds containing at least one oxygen and nitrogen in their molecular structure. Oxazolidine derivatives are known to possess various therapeutic activities, such as anticancer and antibiotic properties.